C13H12BrNO2 — CID 47242031
N-benzyl-5-bromo-3-methylfuran-2-carboxamide (PubChem CID 47242031) has the molecular formula C13H12BrNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is N-benzyl-5-bromo-3-methylfuran-2-carboxamide.
| Compound Name | N-benzyl-5-bromo-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 47242031 |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-benzyl-5-bromo-3-methylfuran-2-carboxamide |
| SMILES | Cc1cc(Br)oc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C13H12BrNO2/c1-9-7-11(14)17-12(9)13(16)15-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,15,16) |
| InChIKey | RIUZAWKIAJCXTF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |