C16H18NO5P — CID 166289865
5-[(3-dimethylphosphorylphenyl)methylcarbamoyl]-4-methylfuran-2-carboxylic acid (PubChem CID 166289865) has the molecular formula C16H18NO5P and a molecular weight of 335.30 g/mol. Its IUPAC name is 5-[(3-dimethylphosphorylphenyl)methylcarbamoyl]-4-methylfuran-2-carboxylic acid.
| Compound Name | 5-[(3-dimethylphosphorylphenyl)methylcarbamoyl]-4-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 166289865 |
| Molecular Formula | C16H18NO5P |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-[(3-dimethylphosphorylphenyl)methylcarbamoyl]-4-methylfuran-2-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)oc1C(=O)NCc1cccc(P(C)(C)=O)c1 |
| InChI | InChI=1S/C16H18NO5P/c1-10-7-13(16(19)20)22-14(10)15(18)17-9-11-5-4-6-12(8-11)23(2,3)21/h4-8H,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | DYYCIQWCDREQCS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|