C9H11BrN2O4 — CID 86787888
2-[(5-bromo-3-methylfuran-2-carbonyl)amino]ethyl carbamate (PubChem CID 86787888) has the molecular formula C9H11BrN2O4 and a molecular weight of 291.10 g/mol. Its IUPAC name is 2-[(5-bromo-3-methylfuran-2-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(5-bromo-3-methylfuran-2-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 86787888 |
| Molecular Formula | C9H11BrN2O4 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-[(5-bromo-3-methylfuran-2-carbonyl)amino]ethyl carbamate |
| SMILES | Cc1cc(Br)oc1C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C9H11BrN2O4/c1-5-4-6(10)16-7(5)8(13)12-2-3-15-9(11)14/h4H,2-3H2,1H3,(H2,11,14)(H,12,13) |
| InChIKey | UPKGVDUJBNSBAO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|