C14H20BrNO4 — CID 95781042
methyl (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-3-ethylpentanoate (PubChem CID 95781042) has the molecular formula C14H20BrNO4 and a molecular weight of 346.22 g/mol. Its IUPAC name is methyl (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-3-ethylpentanoate.
| Compound Name | methyl (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-3-ethylpentanoate |
|---|---|
| PubChem CID | 95781042 |
| Molecular Formula | C14H20BrNO4 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | methyl (2R)-2-[(5-bromo-3-methylfuran-2-carbonyl)amino]-3-ethylpentanoate |
| SMILES | CCC(CC)[C@@H](NC(=O)c1oc(Br)cc1C)C(=O)OC |
| InChI | InChI=1S/C14H20BrNO4/c1-5-9(6-2)11(14(18)19-4)16-13(17)12-8(3)7-10(15)20-12/h7,9,11H,5-6H2,1-4H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | NXBZRJFWDPFELB-LLVKDONJSA-N |
| XLogP | 3.06 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |