C11H15NO5S2 — CID 120689713
3-methyl-4-[(5-methylsulfonylthiophene-3-carbonyl)amino]butanoic acid (PubChem CID 120689713) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-methyl-4-[(5-methylsulfonylthiophene-3-carbonyl)amino]butanoic acid.
| Compound Name | 3-methyl-4-[(5-methylsulfonylthiophene-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120689713 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-methyl-4-[(5-methylsulfonylthiophene-3-carbonyl)amino]butanoic acid |
| SMILES | CC(CNC(=O)c1csc(S(C)(=O)=O)c1)CC(=O)O |
| InChI | InChI=1S/C11H15NO5S2/c1-7(3-9(13)14)5-12-11(15)8-4-10(18-6-8)19(2,16)17/h4,6-7H,3,5H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | IRCYWQNJIQNRPJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |