C9H12ClNO4S2 — CID 102701127
4-(2-methoxypropylcarbamoyl)thiophene-2-sulfonyl chloride (PubChem CID 102701127) has the molecular formula C9H12ClNO4S2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-(2-methoxypropylcarbamoyl)thiophene-2-sulfonyl chloride.
| Compound Name | 4-(2-methoxypropylcarbamoyl)thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 102701127 |
| Molecular Formula | C9H12ClNO4S2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 4-(2-methoxypropylcarbamoyl)thiophene-2-sulfonyl chloride |
| SMILES | COC(C)CNC(=O)c1csc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C9H12ClNO4S2/c1-6(15-2)4-11-9(12)7-3-8(16-5-7)17(10,13)14/h3,5-6H,4H2,1-2H3,(H,11,12) |
| InChIKey | ISEUWJWALHMBBM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |