C11H11Cl4NO4S — CID 102701105
2,4,5-trichloro-3-(2-methoxypropylcarbamoyl)benzenesulfonyl chloride (PubChem CID 102701105) has the molecular formula C11H11Cl4NO4S and a molecular weight of 395.09 g/mol. Its IUPAC name is 2,4,5-trichloro-3-(2-methoxypropylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,4,5-trichloro-3-(2-methoxypropylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 102701105 |
| Molecular Formula | C11H11Cl4NO4S |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | 2,4,5-trichloro-3-(2-methoxypropylcarbamoyl)benzenesulfonyl chloride |
| SMILES | COC(C)CNC(=O)c1c(Cl)c(Cl)cc(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl4NO4S/c1-5(20-2)4-16-11(17)8-9(13)6(12)3-7(10(8)14)21(15,18)19/h3,5H,4H2,1-2H3,(H,16,17) |
| InChIKey | KNVIMDRJNZJAEU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|