C11H10Cl4O4S — CID 65397701
butan-2-yl 2,3,6-trichloro-5-chlorosulfonylbenzoate (PubChem CID 65397701) has the molecular formula C11H10Cl4O4S and a molecular weight of 380.08 g/mol. Its IUPAC name is butan-2-yl 2,3,6-trichloro-5-chlorosulfonylbenzoate.
| Compound Name | butan-2-yl 2,3,6-trichloro-5-chlorosulfonylbenzoate |
|---|---|
| PubChem CID | 65397701 |
| Molecular Formula | C11H10Cl4O4S |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | butan-2-yl 2,3,6-trichloro-5-chlorosulfonylbenzoate |
| SMILES | CCC(C)OC(=O)c1c(Cl)c(Cl)cc(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl4O4S/c1-3-5(2)19-11(16)8-9(13)6(12)4-7(10(8)14)20(15,17)18/h4-5H,3H2,1-2H3 |
| InChIKey | IUTHCIVQIUTNEJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|