C10H14ClNO4S2 — CID 104766562
4-(2-propan-2-yloxyethylcarbamoyl)thiophene-2-sulfonyl chloride (PubChem CID 104766562) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 4-(2-propan-2-yloxyethylcarbamoyl)thiophene-2-sulfonyl chloride.
| Compound Name | 4-(2-propan-2-yloxyethylcarbamoyl)thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 104766562 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-(2-propan-2-yloxyethylcarbamoyl)thiophene-2-sulfonyl chloride |
| SMILES | CC(C)OCCNC(=O)c1csc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C10H14ClNO4S2/c1-7(2)16-4-3-12-10(13)8-5-9(17-6-8)18(11,14)15/h5-7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | ANOCVBCMCUEJKW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|