C10H10BrF3N2O3S — CID 65387521
4-bromo-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 65387521) has the molecular formula C10H10BrF3N2O3S and a molecular weight of 375.17 g/mol. Its IUPAC name is 4-bromo-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 4-bromo-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 65387521 |
| Molecular Formula | C10H10BrF3N2O3S |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 4-bromo-3-sulfamoyl-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H10BrF3N2O3S/c11-7-2-1-6(5-8(7)20(15,18)19)9(17)16-4-3-10(12,13)14/h1-2,5H,3-4H2,(H,16,17)(H2,15,18,19) |
| InChIKey | SSZYAKMSROQJEJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |