C10H9F4NOS — CID 107029487
4-fluoro-3-sulfanyl-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 107029487) has the molecular formula C10H9F4NOS and a molecular weight of 267.25 g/mol. Its IUPAC name is 4-fluoro-3-sulfanyl-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 4-fluoro-3-sulfanyl-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 107029487 |
| Molecular Formula | C10H9F4NOS |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 4-fluoro-3-sulfanyl-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C10H9F4NOS/c11-7-2-1-6(5-8(7)17)9(16)15-4-3-10(12,13)14/h1-2,5,17H,3-4H2,(H,15,16) |
| InChIKey | OWBJENFLMCDHQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|