C17H18N2O5S — CID 31550186
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-sulfamoylbenzamide (PubChem CID 31550186) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-sulfamoylbenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 31550186 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O5S/c1-11-2-4-13(25(18,21)22)9-14(11)17(20)19-7-6-12-3-5-15-16(8-12)24-10-23-15/h2-5,8-9H,6-7,10H2,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | BLZFAQNYYRDKPB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |