C20H26BrNO — CID 4716809
N-[(5-bromo-2-phenylmethoxyphenyl)methyl]hexan-1-amine (PubChem CID 4716809) has the molecular formula C20H26BrNO and a molecular weight of 376.34 g/mol. Its IUPAC name is N-[(5-bromo-2-phenylmethoxyphenyl)methyl]hexan-1-amine.
| Compound Name | N-[(5-bromo-2-phenylmethoxyphenyl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 4716809 |
| Molecular Formula | C20H26BrNO |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[(5-bromo-2-phenylmethoxyphenyl)methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1cc(Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H26BrNO/c1-2-3-4-8-13-22-15-18-14-19(21)11-12-20(18)23-16-17-9-6-5-7-10-17/h5-7,9-12,14,22H,2-4,8,13,15-16H2,1H3 |
| InChIKey | LJCPUKWNJOLFCV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|