C19H32Cl2N2O3 — CID 2951353
N-tert-butyl-2-[4-(butylaminomethyl)-2-chloro-6-ethoxyphenoxy]acetamide;hydrochloride (PubChem CID 2951353) has the molecular formula C19H32Cl2N2O3 and a molecular weight of 407.38 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(butylaminomethyl)-2-chloro-6-ethoxyphenoxy]acetamide;hydrochloride.
| Compound Name | N-tert-butyl-2-[4-(butylaminomethyl)-2-chloro-6-ethoxyphenoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 2951353 |
| Molecular Formula | C19H32Cl2N2O3 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-tert-butyl-2-[4-(butylaminomethyl)-2-chloro-6-ethoxyphenoxy]acetamide;hydrochloride |
| SMILES | CCCCNCc1cc(Cl)c(OCC(=O)NC(C)(C)C)c(OCC)c1.Cl |
| InChI | InChI=1S/C19H31ClN2O3.ClH/c1-6-8-9-21-12-14-10-15(20)18(16(11-14)24-7-2)25-13-17(23)22-19(3,4)5;/h10-11,21H,6-9,12-13H2,1-5H3,(H,22,23);1H |
| InChIKey | JWPYVVOBJZPIFU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|