C20H23ClFN5O2 — CID 4725635
1-butyl-N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]tetrazol-5-amine (PubChem CID 4725635) has the molecular formula C20H23ClFN5O2 and a molecular weight of 419.89 g/mol. Its IUPAC name is 1-butyl-N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]tetrazol-5-amine.
| Compound Name | 1-butyl-N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 4725635 |
| Molecular Formula | C20H23ClFN5O2 |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-butyl-N-[[4-[(2-chloro-4-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]tetrazol-5-amine |
| SMILES | CCCCn1nnnc1NCc1ccc(OCc2ccc(F)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C20H23ClFN5O2/c1-3-4-9-27-20(24-25-26-27)23-12-14-5-8-18(19(10-14)28-2)29-13-15-6-7-16(22)11-17(15)21/h5-8,10-11H,3-4,9,12-13H2,1-2H3,(H,23,24,26) |
| InChIKey | SUPRKSHVXSHYSA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |