C18H20BrN5O2 — CID 17057697
N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine (PubChem CID 17057697) has the molecular formula C18H20BrN5O2 and a molecular weight of 418.30 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 17057697 |
| Molecular Formula | C18H20BrN5O2 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2H-tetrazol-5-amine |
| SMILES | CCOc1cc(CNc2nn[nH]n2)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H20BrN5O2/c1-3-25-16-9-14(10-20-18-21-23-24-22-18)8-15(19)17(16)26-11-13-6-4-12(2)5-7-13/h4-9H,3,10-11H2,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | JVACAPUOLFDNLW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |