C21H27BrFNO2 — CID 17210829
N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine (PubChem CID 17210829) has the molecular formula C21H27BrFNO2 and a molecular weight of 424.35 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 17210829 |
| Molecular Formula | C21H27BrFNO2 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-methylbutan-2-amine |
| SMILES | CCOc1cc(CNC(C)(C)CC)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27BrFNO2/c1-5-21(3,4)24-13-16-11-18(22)20(19(12-16)25-6-2)26-14-15-7-9-17(23)10-8-15/h7-12,24H,5-6,13-14H2,1-4H3 |
| InChIKey | XDPYODCDBFBPOV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |