C22H27BrN6O3S — CID 66534042
2-[5-bromo-2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 66534042) has the molecular formula C22H27BrN6O3S and a molecular weight of 535.47 g/mol. Its IUPAC name is 2-[5-bromo-2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-bromo-2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 66534042 |
| Molecular Formula | C22H27BrN6O3S |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 2-[5-bromo-2-ethoxy-4-[[2-(1-methyltetrazol-5-yl)sulfanylethylamino]methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(CNCCSc2nnnn2C)c(Br)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H27BrN6O3S/c1-4-31-19-11-16(13-24-9-10-33-22-26-27-28-29(22)3)18(23)12-20(19)32-14-21(30)25-17-7-5-15(2)6-8-17/h5-8,11-12,24H,4,9-10,13-14H2,1-3H3,(H,25,30) |
| InChIKey | RJHGUSJTVCMCFY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|