C23H22BrClFNO2 — CID 66534407
N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 66534407) has the molecular formula C23H22BrClFNO2 and a molecular weight of 478.79 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66534407 |
| Molecular Formula | C23H22BrClFNO2 |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | COc1cc(CNCCc2ccc(F)cc2)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22BrClFNO2/c1-28-22-12-18(14-27-11-10-16-4-8-20(26)9-5-16)21(24)13-23(22)29-15-17-2-6-19(25)7-3-17/h2-9,12-13,27H,10-11,14-15H2,1H3 |
| InChIKey | AXHWHXWNDXPCFU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|