C24H24ClN5O2S — CID 4724701
N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 4724701) has the molecular formula C24H24ClN5O2S and a molecular weight of 482.01 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 4724701 |
| Molecular Formula | C24H24ClN5O2S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | COc1cc(CNCCSc2nnnn2-c2ccccc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN5O2S/c1-31-23-15-19(9-12-22(23)32-17-18-7-10-20(25)11-8-18)16-26-13-14-33-24-27-28-29-30(24)21-5-3-2-4-6-21/h2-12,15,26H,13-14,16-17H2,1H3 |
| InChIKey | SHZIPFVUXHSWFL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|