C24H23Cl2N5O2S — CID 4724776
N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine (PubChem CID 4724776) has the molecular formula C24H23Cl2N5O2S and a molecular weight of 516.45 g/mol. Its IUPAC name is N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine.
| Compound Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 4724776 |
| Molecular Formula | C24H23Cl2N5O2S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | N-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-(1-phenyltetrazol-5-yl)sulfanylethanamine |
| SMILES | COc1cc(CNCCSc2nnnn2-c2ccccc2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H23Cl2N5O2S/c1-32-23-14-17(8-10-22(23)33-16-18-7-9-20(25)21(26)13-18)15-27-11-12-34-24-28-29-30-31(24)19-5-3-2-4-6-19/h2-10,13-14,27H,11-12,15-16H2,1H3 |
| InChIKey | RTPSLUUXXMBBQZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|