C24H25BrN2O5 — CID 126122993
N-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline (PubChem CID 126122993) has the molecular formula C24H25BrN2O5 and a molecular weight of 501.38 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 126122993 |
| Molecular Formula | C24H25BrN2O5 |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2cc(Br)c(OCc3ccc([N+](=O)[O-])cc3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C24H25BrN2O5/c1-3-30-21-11-7-19(8-12-21)26-15-18-13-22(25)24(23(14-18)31-4-2)32-16-17-5-9-20(10-6-17)27(28)29/h5-14,26H,3-4,15-16H2,1-2H3 |
| InChIKey | JWQXORKZGYVRDM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|