C22H20Br2N2O3 — CID 126124844
N-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2,3-dimethylaniline (PubChem CID 126124844) has the molecular formula C22H20Br2N2O3 and a molecular weight of 520.22 g/mol. Its IUPAC name is N-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2,3-dimethylaniline.
| Compound Name | N-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 126124844 |
| Molecular Formula | C22H20Br2N2O3 |
| Molecular Weight | 520.22 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | N-[[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-2,3-dimethylaniline |
| SMILES | Cc1cccc(NCc2cc(Br)cc(Br)c2OCc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C22H20Br2N2O3/c1-14-4-3-5-21(15(14)2)25-12-17-10-18(23)11-20(24)22(17)29-13-16-6-8-19(9-7-16)26(27)28/h3-11,25H,12-13H2,1-2H3 |
| InChIKey | QZBKPBOABFTEFB-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.22 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|