C21H19Br2NO — CID 126123365
N-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]aniline (PubChem CID 126123365) has the molecular formula C21H19Br2NO and a molecular weight of 461.20 g/mol. Its IUPAC name is N-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]aniline.
| Compound Name | N-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 126123365 |
| Molecular Formula | C21H19Br2NO |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | N-[[3,5-dibromo-2-[(4-methylphenyl)methoxy]phenyl]methyl]aniline |
| SMILES | Cc1ccc(COc2c(Br)cc(Br)cc2CNc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19Br2NO/c1-15-7-9-16(10-8-15)14-25-21-17(11-18(22)12-20(21)23)13-24-19-5-3-2-4-6-19/h2-12,24H,13-14H2,1H3 |
| InChIKey | KLRCAVVVPJHZGB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |