C20H16BrCl2NO — CID 126122407
N-[[2-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methyl]aniline (PubChem CID 126122407) has the molecular formula C20H16BrCl2NO and a molecular weight of 437.16 g/mol. Its IUPAC name is N-[[2-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methyl]aniline.
| Compound Name | N-[[2-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methyl]aniline |
|---|---|
| PubChem CID | 126122407 |
| Molecular Formula | C20H16BrCl2NO |
| Molecular Weight | 437.16 g/mol |
| Exact Mass | 434.98 |
| IUPAC Name | N-[[2-[(4-bromophenyl)methoxy]-3,5-dichlorophenyl]methyl]aniline |
| SMILES | Clc1cc(Cl)c(OCc2ccc(Br)cc2)c(CNc2ccccc2)c1 |
| InChI | InChI=1S/C20H16BrCl2NO/c21-16-8-6-14(7-9-16)13-25-20-15(10-17(22)11-19(20)23)12-24-18-4-2-1-3-5-18/h1-11,24H,12-13H2 |
| InChIKey | KNYVHIUQNBFLFI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.16 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |