C22H19Cl2NO2 — CID 126124158
N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-phenoxyaniline (PubChem CID 126124158) has the molecular formula C22H19Cl2NO2 and a molecular weight of 400.31 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-phenoxyaniline.
| Compound Name | N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-phenoxyaniline |
|---|---|
| PubChem CID | 126124158 |
| Molecular Formula | C22H19Cl2NO2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-phenoxyaniline |
| SMILES | C=CCOc1c(Cl)cc(Cl)cc1CNc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19Cl2NO2/c1-2-12-26-22-16(13-17(23)14-21(22)24)15-25-18-8-10-20(11-9-18)27-19-6-4-3-5-7-19/h2-11,13-14,25H,1,12,15H2 |
| InChIKey | ORXUWYDJMBPEHU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|