C17H16Cl3NO — CID 126120959
3-chloro-N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-methylaniline (PubChem CID 126120959) has the molecular formula C17H16Cl3NO and a molecular weight of 356.68 g/mol. Its IUPAC name is 3-chloro-N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-methylaniline.
| Compound Name | 3-chloro-N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-methylaniline |
|---|---|
| PubChem CID | 126120959 |
| Molecular Formula | C17H16Cl3NO |
| Molecular Weight | 356.68 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-chloro-N-[(3,5-dichloro-2-prop-2-enoxyphenyl)methyl]-4-methylaniline |
| SMILES | C=CCOc1c(Cl)cc(Cl)cc1CNc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl3NO/c1-3-6-22-17-12(7-13(18)8-16(17)20)10-21-14-5-4-11(2)15(19)9-14/h3-5,7-9,21H,1,6,10H2,2H3 |
| InChIKey | ITPLNOGGXZHFJG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.68 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|