C20H16Cl2FNO — CID 126122230
N-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]aniline (PubChem CID 126122230) has the molecular formula C20H16Cl2FNO and a molecular weight of 376.26 g/mol. Its IUPAC name is N-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]aniline.
| Compound Name | N-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 126122230 |
| Molecular Formula | C20H16Cl2FNO |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-[[3,5-dichloro-4-[(4-fluorophenyl)methoxy]phenyl]methyl]aniline |
| SMILES | Fc1ccc(COc2c(Cl)cc(CNc3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2FNO/c21-18-10-15(12-24-17-4-2-1-3-5-17)11-19(22)20(18)25-13-14-6-8-16(23)9-7-14/h1-11,24H,12-13H2 |
| InChIKey | JRYAJHVYWGWBHP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |