C14H12Br2ClNO — CID 43763039
2-chloro-N-[(3,5-dibromo-2-methoxyphenyl)methyl]aniline (PubChem CID 43763039) has the molecular formula C14H12Br2ClNO and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-chloro-N-[(3,5-dibromo-2-methoxyphenyl)methyl]aniline.
| Compound Name | 2-chloro-N-[(3,5-dibromo-2-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 43763039 |
| Molecular Formula | C14H12Br2ClNO |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | 2-chloro-N-[(3,5-dibromo-2-methoxyphenyl)methyl]aniline |
| SMILES | COc1c(Br)cc(Br)cc1CNc1ccccc1Cl |
| InChI | InChI=1S/C14H12Br2ClNO/c1-19-14-9(6-10(15)7-11(14)16)8-18-13-5-3-2-4-12(13)17/h2-7,18H,8H2,1H3 |
| InChIKey | RYHUNVMHBWLMJG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |