C12H13Br2N3O — CID 43776849
N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1H-pyrazol-4-amine (PubChem CID 43776849) has the molecular formula C12H13Br2N3O and a molecular weight of 375.06 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1H-pyrazol-4-amine.
| Compound Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43776849 |
| Molecular Formula | C12H13Br2N3O |
| Molecular Weight | 375.06 g/mol |
| Exact Mass | 372.94 |
| IUPAC Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1H-pyrazol-4-amine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNc1cn[nH]c1 |
| InChI | InChI=1S/C12H13Br2N3O/c1-2-18-12-8(3-9(13)4-11(12)14)5-15-10-6-16-17-7-10/h3-4,6-7,15H,2,5H2,1H3,(H,16,17) |
| InChIKey | CAJZNSPUXYJGFD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.06 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |