C13H15Br2N3O — CID 43776644
N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1-methylpyrazol-4-amine (PubChem CID 43776644) has the molecular formula C13H15Br2N3O and a molecular weight of 389.09 g/mol. Its IUPAC name is N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1-methylpyrazol-4-amine.
| Compound Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 43776644 |
| Molecular Formula | C13H15Br2N3O |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | N-[(3,5-dibromo-2-ethoxyphenyl)methyl]-1-methylpyrazol-4-amine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNc1cnn(C)c1 |
| InChI | InChI=1S/C13H15Br2N3O/c1-3-19-13-9(4-10(14)5-12(13)15)6-16-11-7-17-18(2)8-11/h4-5,7-8,16H,3,6H2,1-2H3 |
| InChIKey | IFWDBAYIZPSBLA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |