About 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane
3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane (PubChem CID 144590041) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane.
Molecular Properties
| Compound Name | 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane |
| PubChem CID | 144590041 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane |
| SMILES | CCOC.N#Cc1cc(O)cc(OCC=O)c1 |
| InChI | InChI=1S/C9H7NO3.C3H8O/c10-6-7-3-8(12)5-9(4-7)13-2-1-11;1-3-4-2/h1,3-5,12H,2H2;3H2,1-2H3 |
| InChIKey | MYTTXGZZDACJIW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane?
The IUPAC name of 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane (CID 144590041) is 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane.
What is the SMILES notation for 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane?
The canonical SMILES for 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane is CCOC.N#Cc1cc(O)cc(OCC=O)c1.
What is the InChIKey of 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane?
The InChIKey is MYTTXGZZDACJIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3.C3H8O/c10-6-7-3-8(12)5-9(4-7)13-2-1-11;1-3-4-2/h1,3-5,12H,2H2;3H2,1-2H3.
What are the key properties of 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane?
3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane has a molecular weight of 237.25 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-5-(2-oxoethoxy)benzonitrile;methoxyethane is sourced from PubChem (CID 144590041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).