About 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal
4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal (PubChem CID 163226091) has the molecular formula C10H11F5O2S
and a molecular weight of 290.25 g/mol. Its IUPAC name is 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal.
Molecular Properties
| Compound Name | 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal |
| PubChem CID | 163226091 |
| Molecular Formula | C10H11F5O2S |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal |
| SMILES | O=CCCCOc1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F5O2S/c11-18(12,13,14,15)10-5-3-9(4-6-10)17-8-2-1-7-16/h3-7H,1-2,8H2 |
| InChIKey | CFVKBCCBPDGIIB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal?
The IUPAC name of 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal (CID 163226091) is 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal.
What is the SMILES notation for 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal?
The canonical SMILES for 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal is O=CCCCOc1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal?
The InChIKey is CFVKBCCBPDGIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F5O2S/c11-18(12,13,14,15)10-5-3-9(4-6-10)17-8-2-1-7-16/h3-7H,1-2,8H2.
What are the key properties of 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal?
4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal has a molecular weight of 290.25 g/mol, XLogP of 4.70, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(pentafluoro-λ6-sulfanyl)phenoxy]butanal is sourced from PubChem (CID 163226091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).