C31H30N2O2 — CID 142316254
6-heptoxy-19-hydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile (PubChem CID 142316254) has the molecular formula C31H30N2O2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 6-heptoxy-19-hydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile.
| Compound Name | 6-heptoxy-19-hydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 142316254 |
| Molecular Formula | C31H30N2O2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 6-heptoxy-19-hydroxypentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaene-12,13-dicarbonitrile |
| SMILES | CCCCCCCOc1ccc2c(c1)CCc1c(C#N)c(C#N)c3c(c1-2)-c1ccc(O)cc1CC3 |
| InChI | InChI=1S/C31H30N2O2/c1-2-3-4-5-6-15-35-23-10-14-25-21(17-23)8-12-27-29(19-33)28(18-32)26-11-7-20-16-22(34)9-13-24(20)30(26)31(25)27/h9-10,13-14,16-17,34H,2-8,11-12,15H2,1H3 |
| InChIKey | BFTOSJUHCGLYPV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|