C30H26N2O4 — CID 134400540
6-[(12,13-dicyano-19-hydroxy-6-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaenyl)oxy]hexanoic acid (PubChem CID 134400540) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 6-[(12,13-dicyano-19-hydroxy-6-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaenyl)oxy]hexanoic acid.
| Compound Name | 6-[(12,13-dicyano-19-hydroxy-6-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaenyl)oxy]hexanoic acid |
|---|---|
| PubChem CID | 134400540 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 6-[(12,13-dicyano-19-hydroxy-6-pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17(22),18,20-nonaenyl)oxy]hexanoic acid |
| SMILES | N#Cc1c(C#N)c2c(c3c1CCc1cc(O)ccc1-3)-c1ccc(OCCCCCC(=O)O)cc1CC2 |
| InChI | InChI=1S/C30H26N2O4/c31-16-26-24-9-5-18-14-20(33)7-11-22(18)29(24)30-23-12-8-21(36-13-3-1-2-4-28(34)35)15-19(23)6-10-25(30)27(26)17-32/h7-8,11-12,14-15,33H,1-6,9-10,13H2,(H,34,35) |
| InChIKey | TWIPAJOHFIFVCP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|