C30H26N2O2 — CID 134400774
6-(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17,19,21-nonaene-12,13-dicarbonitrile (PubChem CID 134400774) has the molecular formula C30H26N2O2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 6-(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17,19,21-nonaene-12,13-dicarbonitrile.
| Compound Name | 6-(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17,19,21-nonaene-12,13-dicarbonitrile |
|---|---|
| PubChem CID | 134400774 |
| Molecular Formula | C30H26N2O2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 6-(6-oxohexoxy)pentacyclo[12.8.0.02,11.03,8.017,22]docosa-1,3(8),4,6,11,13,17,19,21-nonaene-12,13-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c2c(c3c1CCc1ccccc1-3)-c1ccc(OCCCCCC=O)cc1CC2 |
| InChI | InChI=1S/C30H26N2O2/c31-18-27-25-12-9-20-7-3-4-8-23(20)29(25)30-24-14-11-22(34-16-6-2-1-5-15-33)17-21(24)10-13-26(30)28(27)19-32/h3-4,7-8,11,14-15,17H,1-2,5-6,9-10,12-13,16H2 |
| InChIKey | USZSDNYMWREYKL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|