C38H42N2O4 — CID 142316255
4-[2-[2-methyl-5-(6-oxohexoxy)phenyl]ethyl]-13-(6-oxohexoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-5,6-dicarbonitrile (PubChem CID 142316255) has the molecular formula C38H42N2O4 and a molecular weight of 590.76 g/mol. Its IUPAC name is 4-[2-[2-methyl-5-(6-oxohexoxy)phenyl]ethyl]-13-(6-oxohexoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-5,6-dicarbonitrile.
| Compound Name | 4-[2-[2-methyl-5-(6-oxohexoxy)phenyl]ethyl]-13-(6-oxohexoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 142316255 |
| Molecular Formula | C38H42N2O4 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 4-[2-[2-methyl-5-(6-oxohexoxy)phenyl]ethyl]-13-(6-oxohexoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-5,6-dicarbonitrile |
| SMILES | Cc1ccc(OCCCCCC=O)cc1CCc1cc2c(c(C#N)c1C#N)CCCc1cc(OCCCCCC=O)ccc1-2 |
| InChI | InChI=1S/C38H42N2O4/c1-28-13-16-32(43-21-8-4-2-6-19-41)23-29(28)14-15-31-25-36-34-18-17-33(44-22-9-5-3-7-20-42)24-30(34)11-10-12-35(36)38(27-40)37(31)26-39/h13,16-20,23-25H,2-12,14-15,21-22H2,1H3 |
| InChIKey | MTHGVFWIKSCIDD-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|