C21H24O4S — CID 118619510
13-(3-ethylsulfonylpropoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde (PubChem CID 118619510) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 13-(3-ethylsulfonylpropoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde.
| Compound Name | 13-(3-ethylsulfonylpropoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde |
|---|---|
| PubChem CID | 118619510 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 13-(3-ethylsulfonylpropoxy)tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde |
| SMILES | CCS(=O)(=O)CCCOc1ccc2c(c1)CCCc1ccc(C=O)cc1-2 |
| InChI | InChI=1S/C21H24O4S/c1-2-26(23,24)12-4-11-25-19-9-10-20-18(14-19)6-3-5-17-8-7-16(15-22)13-21(17)20/h7-10,13-15H,2-6,11-12H2,1H3 |
| InChIKey | AVVXWNXYSMIYLB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|