C23H28O5S — CID 118630012
methyl 13-(3-ethylsulfonylpropoxy)-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carboxylate (PubChem CID 118630012) has the molecular formula C23H28O5S and a molecular weight of 416.54 g/mol. Its IUPAC name is methyl 13-(3-ethylsulfonylpropoxy)-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carboxylate.
| Compound Name | methyl 13-(3-ethylsulfonylpropoxy)-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 118630012 |
| Molecular Formula | C23H28O5S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl 13-(3-ethylsulfonylpropoxy)-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carboxylate |
| SMILES | CCS(=O)(=O)CCCOc1cc(C)c2c(c1)CCCc1ccc(C(=O)OC)cc1-2 |
| InChI | InChI=1S/C23H28O5S/c1-4-29(25,26)12-6-11-28-20-13-16(2)22-18(14-20)8-5-7-17-9-10-19(15-21(17)22)23(24)27-3/h9-10,13-15H,4-8,11-12H2,1-3H3 |
| InChIKey | VTEHLRBAXOBFLC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|