C32H33N3O4 — CID 118619072
methyl 5-[bis[(4-methoxyphenyl)methyl]amino]-3-methyl-4,6-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-14-carboxylate (PubChem CID 118619072) has the molecular formula C32H33N3O4 and a molecular weight of 523.63 g/mol. Its IUPAC name is methyl 5-[bis[(4-methoxyphenyl)methyl]amino]-3-methyl-4,6-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-14-carboxylate.
| Compound Name | methyl 5-[bis[(4-methoxyphenyl)methyl]amino]-3-methyl-4,6-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 118619072 |
| Molecular Formula | C32H33N3O4 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | methyl 5-[bis[(4-methoxyphenyl)methyl]amino]-3-methyl-4,6-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-14-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)-c1c(C)nc(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)nc1CCC2 |
| InChI | InChI=1S/C32H33N3O4/c1-21-30-28-18-25(31(36)39-4)13-12-24(28)6-5-7-29(30)34-32(33-21)35(19-22-8-14-26(37-2)15-9-22)20-23-10-16-27(38-3)17-11-23/h8-18H,5-7,19-20H2,1-4H3 |
| InChIKey | GNDOKLIGNOIKQM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |