C34H41NO5S — CID 118630005
trans-ethyl (1S,2S)-2-[4-[[13-(3-ethylsulfonylpropoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methylamino]phenyl]cyclopropane-1-carboxylate (PubChem CID 118630005) has the molecular formula C34H41NO5S and a molecular weight of 575.77 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-[4-[[13-(3-ethylsulfonylpropoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methylamino]phenyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-[4-[[13-(3-ethylsulfonylpropoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methylamino]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118630005 |
| Molecular Formula | C34H41NO5S |
| Molecular Weight | 575.77 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | trans-ethyl (1S,2S)-2-[4-[[13-(3-ethylsulfonylpropoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methylamino]phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1c1ccc(NCc2ccc3c(c2)-c2c(C)cc(OCCCS(=O)(=O)CC)cc2CCC3)cc1 |
| InChI | InChI=1S/C34H41NO5S/c1-4-39-34(36)32-21-30(32)26-12-14-28(15-13-26)35-22-24-10-11-25-8-6-9-27-20-29(18-23(3)33(27)31(25)19-24)40-16-7-17-41(37,38)5-2/h10-15,18-20,30,32,35H,4-9,16-17,21-22H2,1-3H3/t30-,32+/m1/s1 |
| InChIKey | ABHWGUXUYUDMDJ-BHYZAODMSA-N |
| XLogP | 6.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.77 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|