C21H26O3 — CID 118619241
[13-(2-ethoxyethoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methanol (PubChem CID 118619241) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is [13-(2-ethoxyethoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methanol.
| Compound Name | [13-(2-ethoxyethoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methanol |
|---|---|
| PubChem CID | 118619241 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [13-(2-ethoxyethoxy)-15-methyl-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methanol |
| SMILES | CCOCCOc1cc(C)c2c(c1)CCCc1ccc(CO)cc1-2 |
| InChI | InChI=1S/C21H26O3/c1-3-23-9-10-24-19-11-15(2)21-18(13-19)6-4-5-17-8-7-16(14-22)12-20(17)21/h7-8,11-13,22H,3-6,9-10,14H2,1-2H3 |
| InChIKey | XEVBIOCYEUFPHN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|