C29H33NO3S — CID 144692257
4-[[14-(anilinomethyl)-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1-oxothian-4-ol (PubChem CID 144692257) has the molecular formula C29H33NO3S and a molecular weight of 475.65 g/mol. Its IUPAC name is 4-[[14-(anilinomethyl)-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1-oxothian-4-ol.
| Compound Name | 4-[[14-(anilinomethyl)-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1-oxothian-4-ol |
|---|---|
| PubChem CID | 144692257 |
| Molecular Formula | C29H33NO3S |
| Molecular Weight | 475.65 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 4-[[14-(anilinomethyl)-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1-oxothian-4-ol |
| SMILES | Cc1cc(OCC2(O)CCS(=O)CC2)cc2c1-c1cc(CNc3ccccc3)ccc1CCC2 |
| InChI | InChI=1S/C29H33NO3S/c1-21-16-26(33-20-29(31)12-14-34(32)15-13-29)18-24-7-5-6-23-11-10-22(17-27(23)28(21)24)19-30-25-8-3-2-4-9-25/h2-4,8-11,16-18,30-31H,5-7,12-15,19-20H2,1H3 |
| InChIKey | IDLQOYJHVQKPHQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |