C35H42O4S — CID 144692321
ethyl cyclopropanecarboxylate;1-methylidene-4-[[3-methyl-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxy]thiane (PubChem CID 144692321) has the molecular formula C35H42O4S and a molecular weight of 558.78 g/mol. Its IUPAC name is ethyl cyclopropanecarboxylate;1-methylidene-4-[[3-methyl-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxy]thiane.
| Compound Name | ethyl cyclopropanecarboxylate;1-methylidene-4-[[3-methyl-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxy]thiane |
|---|---|
| PubChem CID | 144692321 |
| Molecular Formula | C35H42O4S |
| Molecular Weight | 558.78 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | ethyl cyclopropanecarboxylate;1-methylidene-4-[[3-methyl-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxy]thiane |
| SMILES | C=S1CCC(Oc2cc(C)c3c(c2)CCCc2ccc(COc4ccccc4)cc2-3)CC1.CCOC(=O)C1CC1 |
| InChI | InChI=1S/C29H32O2S.C6H10O2/c1-21-17-27(31-26-13-15-32(2)16-14-26)19-24-8-6-7-23-12-11-22(18-28(23)29(21)24)20-30-25-9-4-3-5-10-25;1-2-8-6(7)5-3-4-5/h3-5,9-12,17-19,26H,2,6-8,13-16,20H2,1H3;5H,2-4H2,1H3 |
| InChIKey | JXPFAVAYIVAXTO-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.78 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|