C29H32O4S — CID 144692313
3-[4-[[5-methyl-7-(3-methylsulfanylpropoxy)-9,10-dihydrophenanthren-3-yl]methoxy]phenyl]propanoic acid (PubChem CID 144692313) has the molecular formula C29H32O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is 3-[4-[[5-methyl-7-(3-methylsulfanylpropoxy)-9,10-dihydrophenanthren-3-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[5-methyl-7-(3-methylsulfanylpropoxy)-9,10-dihydrophenanthren-3-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144692313 |
| Molecular Formula | C29H32O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[4-[[5-methyl-7-(3-methylsulfanylpropoxy)-9,10-dihydrophenanthren-3-yl]methoxy]phenyl]propanoic acid |
| SMILES | CSCCCOc1cc(C)c2c(c1)CCc1ccc(COc3ccc(CCC(=O)O)cc3)cc1-2 |
| InChI | InChI=1S/C29H32O4S/c1-20-16-26(32-14-3-15-34-2)18-24-10-9-23-8-4-22(17-27(23)29(20)24)19-33-25-11-5-21(6-12-25)7-13-28(30)31/h4-6,8,11-12,16-18H,3,7,9-10,13-15,19H2,1-2H3,(H,30,31) |
| InChIKey | QQWGMCLZSORJRK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|