C21H24O6S — CID 118619150
methyl 11-methyl-9-(3-methylsulfonylpropoxy)-6,7-dihydrobenzo[d][1]benzoxepine-2-carboxylate (PubChem CID 118619150) has the molecular formula C21H24O6S and a molecular weight of 404.48 g/mol. Its IUPAC name is methyl 11-methyl-9-(3-methylsulfonylpropoxy)-6,7-dihydrobenzo[d][1]benzoxepine-2-carboxylate.
| Compound Name | methyl 11-methyl-9-(3-methylsulfonylpropoxy)-6,7-dihydrobenzo[d][1]benzoxepine-2-carboxylate |
|---|---|
| PubChem CID | 118619150 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | methyl 11-methyl-9-(3-methylsulfonylpropoxy)-6,7-dihydrobenzo[d][1]benzoxepine-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)-c1c(C)cc(OCCCS(C)(=O)=O)cc1CCO2 |
| InChI | InChI=1S/C21H24O6S/c1-14-11-17(26-8-4-10-28(3,23)24)12-15-7-9-27-19-6-5-16(21(22)25-2)13-18(19)20(14)15/h5-6,11-13H,4,7-10H2,1-3H3 |
| InChIKey | VGFFAGXOTUGQPY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|