C22H24O5S — CID 118619239
13-[(4-hydroxy-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde (PubChem CID 118619239) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is 13-[(4-hydroxy-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde.
| Compound Name | 13-[(4-hydroxy-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde |
|---|---|
| PubChem CID | 118619239 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 13-[(4-hydroxy-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)-c1ccc(OCC3(O)CCS(=O)(=O)CC3)cc1CCC2 |
| InChI | InChI=1S/C22H24O5S/c23-14-16-4-5-17-2-1-3-18-13-19(6-7-20(18)21(17)12-16)27-15-22(24)8-10-28(25,26)11-9-22/h4-7,12-14,24H,1-3,8-11,15H2 |
| InChIKey | ROBQWBYCUBVMDV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|