C28H29FO5S — CID 129107032
4-[[13-fluoro-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol (PubChem CID 129107032) has the molecular formula C28H29FO5S and a molecular weight of 496.60 g/mol. Its IUPAC name is 4-[[13-fluoro-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol.
| Compound Name | 4-[[13-fluoro-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 129107032 |
| Molecular Formula | C28H29FO5S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 4-[[13-fluoro-14-(phenoxymethyl)-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol |
| SMILES | O=S1(=O)CCC(O)(COc2ccc3c(c2)CCCc2cc(F)c(COc4ccccc4)cc2-3)CC1 |
| InChI | InChI=1S/C28H29FO5S/c29-27-17-21-6-4-5-20-15-24(34-19-28(30)11-13-35(31,32)14-12-28)9-10-25(20)26(21)16-22(27)18-33-23-7-2-1-3-8-23/h1-3,7-10,15-17,30H,4-6,11-14,18-19H2 |
| InChIKey | NFBKZWORAXDAFK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |