C23H28O3S — CID 163856837
4-[(14-ethyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)oxymethyl]thiane 1,1-dioxide (PubChem CID 163856837) has the molecular formula C23H28O3S and a molecular weight of 384.54 g/mol. Its IUPAC name is 4-[(14-ethyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)oxymethyl]thiane 1,1-dioxide.
| Compound Name | 4-[(14-ethyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)oxymethyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 163856837 |
| Molecular Formula | C23H28O3S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 4-[(14-ethyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl)oxymethyl]thiane 1,1-dioxide |
| SMILES | CCc1ccc2c(c1)-c1ccc(OCC3CCS(=O)(=O)CC3)cc1CCC2 |
| InChI | InChI=1S/C23H28O3S/c1-2-17-6-7-19-4-3-5-20-15-21(8-9-22(20)23(19)14-17)26-16-18-10-12-27(24,25)13-11-18/h6-9,14-15,18H,2-5,10-13,16H2,1H3 |
| InChIKey | OZAIOYFGYSZGDI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |