C15H21NO3S — CID 115075515
4-(1,2,3,4-tetrahydroquinolin-7-yloxymethyl)thiane 1,1-dioxide (PubChem CID 115075515) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydroquinolin-7-yloxymethyl)thiane 1,1-dioxide.
| Compound Name | 4-(1,2,3,4-tetrahydroquinolin-7-yloxymethyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 115075515 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-(1,2,3,4-tetrahydroquinolin-7-yloxymethyl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(COc2ccc3c(c2)NCCC3)CC1 |
| InChI | InChI=1S/C15H21NO3S/c17-20(18)8-5-12(6-9-20)11-19-14-4-3-13-2-1-7-16-15(13)10-14/h3-4,10,12,16H,1-2,5-9,11H2 |
| InChIKey | VNMDISGSRCQKQD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |